C34H33NO2 — CID 174511731
1H-azepine;(1-ethyl-1,2,3,6-tetrahydrochrysen-3-yl)-(4-methoxyphenyl)methanone (PubChem CID 174511731) has the molecular formula C34H33NO2 and a molecular weight of 487.64 g/mol. Its IUPAC name is 1H-azepine;(1-ethyl-1,2,3,6-tetrahydrochrysen-3-yl)-(4-methoxyphenyl)methanone.
| Compound Name | 1H-azepine;(1-ethyl-1,2,3,6-tetrahydrochrysen-3-yl)-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 174511731 |
| Molecular Formula | C34H33NO2 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 1H-azepine;(1-ethyl-1,2,3,6-tetrahydrochrysen-3-yl)-(4-methoxyphenyl)methanone |
| SMILES | C1=CC=CNC=C1.CCC1CC(C(=O)c2ccc(OC)cc2)C=c2c1ccc1c2=CCc2ccccc2-1 |
| InChI | InChI=1S/C28H26O2.C6H7N/c1-3-18-16-21(28(29)20-8-11-22(30-2)12-9-20)17-27-24(18)14-15-25-23-7-5-4-6-19(23)10-13-26(25)27;1-2-4-6-7-5-3-1/h4-9,11-15,17-18,21H,3,10,16H2,1-2H3;1-7H |
| InChIKey | OCPIXDKEGXFBOU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |