C14H17F4NO2 — CID 174512740
methyl 2-amino-4-methyl-5-(2,3,4,6-tetrafluorophenyl)hexanoate (PubChem CID 174512740) has the molecular formula C14H17F4NO2 and a molecular weight of 307.29 g/mol. Its IUPAC name is methyl 2-amino-4-methyl-5-(2,3,4,6-tetrafluorophenyl)hexanoate.
| Compound Name | methyl 2-amino-4-methyl-5-(2,3,4,6-tetrafluorophenyl)hexanoate |
|---|---|
| PubChem CID | 174512740 |
| Molecular Formula | C14H17F4NO2 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | methyl 2-amino-4-methyl-5-(2,3,4,6-tetrafluorophenyl)hexanoate |
| SMILES | COC(=O)C(N)CC(C)C(C)c1c(F)cc(F)c(F)c1F |
| InChI | InChI=1S/C14H17F4NO2/c1-6(4-10(19)14(20)21-3)7(2)11-8(15)5-9(16)12(17)13(11)18/h5-7,10H,4,19H2,1-3H3 |
| InChIKey | YQGOCBNXPFXSRO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|