About 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate
7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate (PubChem CID 174512971) has the molecular formula C21H26BrN5O4S
and a molecular weight of 524.44 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate.
Molecular Properties
| Compound Name | 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate |
| PubChem CID | 174512971 |
| Molecular Formula | C21H26BrN5O4S |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.O=S(=O)(c1ccccc1)n1cc(Br)c2c(N3CCNCC3)ncnc21 |
| InChI | InChI=1S/C16H16BrN5O2S.C5H10O2/c17-13-10-22(25(23,24)12-4-2-1-3-5-12)16-14(13)15(19-11-20-16)21-8-6-18-7-9-21;1-5(2,3)7-4-6/h1-5,10-11,18H,6-9H2;4H,1-3H3 |
| InChIKey | KEZJOCGOWGUKDF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate?
The IUPAC name of 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate (CID 174512971) is 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate.
What is the SMILES notation for 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate?
The canonical SMILES for 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate is CC(C)(C)OC=O.O=S(=O)(c1ccccc1)n1cc(Br)c2c(N3CCNCC3)ncnc21.
What is the InChIKey of 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate?
The InChIKey is KEZJOCGOWGUKDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrN5O2S.C5H10O2/c17-13-10-22(25(23,24)12-4-2-1-3-5-12)16-14(13)15(19-11-20-16)21-8-6-18-7-9-21;1-5(2,3)7-4-6/h1-5,10-11,18H,6-9H2;4H,1-3H3.
What are the key properties of 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate?
7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate has a molecular weight of 524.44 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(benzenesulfonyl)-5-bromo-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidine;tert-butyl formate is sourced from PubChem (CID 174512971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).