C12H10O2 — CID 174513009
10-oxatetracyclo[6.5.0.02,7.09,11]trideca-1(8),2,4,6,12-pentaene;hydrate (PubChem CID 174513009) has the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 10-oxatetracyclo[6.5.0.02,7.09,11]trideca-1(8),2,4,6,12-pentaene;hydrate.
| Compound Name | 10-oxatetracyclo[6.5.0.02,7.09,11]trideca-1(8),2,4,6,12-pentaene;hydrate |
|---|---|
| PubChem CID | 174513009 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 10-oxatetracyclo[6.5.0.02,7.09,11]trideca-1(8),2,4,6,12-pentaene;hydrate |
| SMILES | C1=CC2OC2C2=C1c1ccccc12.O |
| InChI | InChI=1S/C12H8O.H2O/c1-2-4-8-7(3-1)9-5-6-10-12(13-10)11(8)9;/h1-6,10,12H;1H2 |
| InChIKey | SUNKVHUZNDMUGM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 44.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|