About 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole
6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole (PubChem CID 174513026) has the molecular formula C18H16Cl2N2OS
and a molecular weight of 379.31 g/mol. Its IUPAC name is 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole |
| PubChem CID | 174513026 |
| Molecular Formula | C18H16Cl2N2OS |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole |
| SMILES | Clc1cccc(OC2CCN(c3ccc4ncsc4c3)CC2)c1Cl |
| InChI | InChI=1S/C18H16Cl2N2OS/c19-14-2-1-3-16(18(14)20)23-13-6-8-22(9-7-13)12-4-5-15-17(10-12)24-11-21-15/h1-5,10-11,13H,6-9H2 |
| InChIKey | ISWWFPXVRADXAQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole?
The IUPAC name of 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole (CID 174513026) is 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole.
What is the SMILES notation for 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole?
The canonical SMILES for 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole is Clc1cccc(OC2CCN(c3ccc4ncsc4c3)CC2)c1Cl.
What is the InChIKey of 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole?
The InChIKey is ISWWFPXVRADXAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl2N2OS/c19-14-2-1-3-16(18(14)20)23-13-6-8-22(9-7-13)12-4-5-15-17(10-12)24-11-21-15/h1-5,10-11,13H,6-9H2.
What are the key properties of 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole?
6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole has a molecular weight of 379.31 g/mol, XLogP of 5.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(2,3-dichlorophenoxy)piperidin-1-yl]-1,3-benzothiazole is sourced from PubChem (CID 174513026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).