About tert-butyl carbamate;4-propylaniline
tert-butyl carbamate;4-propylaniline (PubChem CID 174513475) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is tert-butyl carbamate;4-propylaniline.
Molecular Properties
| Compound Name | tert-butyl carbamate;4-propylaniline |
| PubChem CID | 174513475 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | tert-butyl carbamate;4-propylaniline |
| SMILES | CC(C)(C)OC(N)=O.CCCc1ccc(N)cc1 |
| InChI | InChI=1S/C9H13N.C5H11NO2/c1-2-3-8-4-6-9(10)7-5-8;1-5(2,3)8-4(6)7/h4-7H,2-3,10H2,1H3;1-3H3,(H2,6,7) |
| InChIKey | UNNOOUCCJBSJPT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl carbamate;4-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl carbamate;4-propylaniline?
The IUPAC name of tert-butyl carbamate;4-propylaniline (CID 174513475) is tert-butyl carbamate;4-propylaniline.
What is the SMILES notation for tert-butyl carbamate;4-propylaniline?
The canonical SMILES for tert-butyl carbamate;4-propylaniline is CC(C)(C)OC(N)=O.CCCc1ccc(N)cc1.
What is the InChIKey of tert-butyl carbamate;4-propylaniline?
The InChIKey is UNNOOUCCJBSJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C5H11NO2/c1-2-3-8-4-6-9(10)7-5-8;1-5(2,3)8-4(6)7/h4-7H,2-3,10H2,1H3;1-3H3,(H2,6,7).
What are the key properties of tert-butyl carbamate;4-propylaniline?
tert-butyl carbamate;4-propylaniline has a molecular weight of 252.36 g/mol, XLogP of 3.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl carbamate;4-propylaniline is sourced from PubChem (CID 174513475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).