About N-carbamothioylacetamide;prop-2-enylthiourea
N-carbamothioylacetamide;prop-2-enylthiourea (PubChem CID 174513700) has the molecular formula C7H14N4OS2
and a molecular weight of 234.35 g/mol. Its IUPAC name is N-carbamothioylacetamide;prop-2-enylthiourea.
Molecular Properties
| Compound Name | N-carbamothioylacetamide;prop-2-enylthiourea |
| PubChem CID | 174513700 |
| Molecular Formula | C7H14N4OS2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | N-carbamothioylacetamide;prop-2-enylthiourea |
| SMILES | C=CCNC(N)=S.CC(=O)NC(N)=S |
| InChI | InChI=1S/C4H8N2S.C3H6N2OS/c1-2-3-6-4(5)7;1-2(6)5-3(4)7/h2H,1,3H2,(H3,5,6,7);1H3,(H3,4,5,6,7) |
| InChIKey | PDBNQCYGYFXGKS-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-carbamothioylacetamide;prop-2-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamothioylacetamide;prop-2-enylthiourea?
The IUPAC name of N-carbamothioylacetamide;prop-2-enylthiourea (CID 174513700) is N-carbamothioylacetamide;prop-2-enylthiourea.
What is the SMILES notation for N-carbamothioylacetamide;prop-2-enylthiourea?
The canonical SMILES for N-carbamothioylacetamide;prop-2-enylthiourea is C=CCNC(N)=S.CC(=O)NC(N)=S.
What is the InChIKey of N-carbamothioylacetamide;prop-2-enylthiourea?
The InChIKey is PDBNQCYGYFXGKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2S.C3H6N2OS/c1-2-3-6-4(5)7;1-2(6)5-3(4)7/h2H,1,3H2,(H3,5,6,7);1H3,(H3,4,5,6,7).
What are the key properties of N-carbamothioylacetamide;prop-2-enylthiourea?
N-carbamothioylacetamide;prop-2-enylthiourea has a molecular weight of 234.35 g/mol, XLogP of -0.63, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamothioylacetamide;prop-2-enylthiourea is sourced from PubChem (CID 174513700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).