About (2,5-dimethylanilino) methanesulfonate
(2,5-dimethylanilino) methanesulfonate (PubChem CID 174513773) has the molecular formula C9H13NO3S
and a molecular weight of 215.27 g/mol. Its IUPAC name is (2,5-dimethylanilino) methanesulfonate.
Molecular Properties
| Compound Name | (2,5-dimethylanilino) methanesulfonate |
| PubChem CID | 174513773 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (2,5-dimethylanilino) methanesulfonate |
| SMILES | Cc1ccc(C)c(NOS(C)(=O)=O)c1 |
| InChI | InChI=1S/C9H13NO3S/c1-7-4-5-8(2)9(6-7)10-13-14(3,11)12/h4-6,10H,1-3H3 |
| InChIKey | UFIBNKVTOFKGBV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dimethylanilino) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethylanilino) methanesulfonate?
The IUPAC name of (2,5-dimethylanilino) methanesulfonate (CID 174513773) is (2,5-dimethylanilino) methanesulfonate.
What is the SMILES notation for (2,5-dimethylanilino) methanesulfonate?
The canonical SMILES for (2,5-dimethylanilino) methanesulfonate is Cc1ccc(C)c(NOS(C)(=O)=O)c1.
What is the InChIKey of (2,5-dimethylanilino) methanesulfonate?
The InChIKey is UFIBNKVTOFKGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S/c1-7-4-5-8(2)9(6-7)10-13-14(3,11)12/h4-6,10H,1-3H3.
What are the key properties of (2,5-dimethylanilino) methanesulfonate?
(2,5-dimethylanilino) methanesulfonate has a molecular weight of 215.27 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethylanilino) methanesulfonate is sourced from PubChem (CID 174513773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).