C11H13FN2 — CID 174514040
3-[2-(aminomethyl)-5-fluorophenyl]-2-methylpropanenitrile (PubChem CID 174514040) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-5-fluorophenyl]-2-methylpropanenitrile.
| Compound Name | 3-[2-(aminomethyl)-5-fluorophenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 174514040 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3-[2-(aminomethyl)-5-fluorophenyl]-2-methylpropanenitrile |
| SMILES | CC(C#N)Cc1cc(F)ccc1CN |
| InChI | InChI=1S/C11H13FN2/c1-8(6-13)4-10-5-11(12)3-2-9(10)7-14/h2-3,5,8H,4,7,14H2,1H3 |
| InChIKey | OUDFDULXTBSTBY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |