About aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate
aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate (PubChem CID 174514294) has the molecular formula C16H17NO2S2
and a molecular weight of 319.45 g/mol. Its IUPAC name is aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate.
Molecular Properties
| Compound Name | aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate |
| PubChem CID | 174514294 |
| Molecular Formula | C16H17NO2S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate |
| SMILES | COC(=O)C1(c2cccs2)CC=CS1.Nc1ccccc1 |
| InChI | InChI=1S/C10H10O2S2.C6H7N/c1-12-9(11)10(5-3-7-14-10)8-4-2-6-13-8;7-6-4-2-1-3-5-6/h2-4,6-7H,5H2,1H3;1-5H,7H2 |
| InChIKey | HXGYGLCBJPQQNN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate?
The IUPAC name of aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate (CID 174514294) is aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate.
What is the SMILES notation for aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate?
The canonical SMILES for aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate is COC(=O)C1(c2cccs2)CC=CS1.Nc1ccccc1.
What is the InChIKey of aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate?
The InChIKey is HXGYGLCBJPQQNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2S2.C6H7N/c1-12-9(11)10(5-3-7-14-10)8-4-2-6-13-8;7-6-4-2-1-3-5-6/h2-4,6-7H,5H2,1H3;1-5H,7H2.
What are the key properties of aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate?
aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate has a molecular weight of 319.45 g/mol, XLogP of 4.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;methyl 2-thiophen-2-yl-3H-thiophene-2-carboxylate is sourced from PubChem (CID 174514294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).