About N-phenyl-2H-triazole-4-sulfonamide;pyrimidine
N-phenyl-2H-triazole-4-sulfonamide;pyrimidine (PubChem CID 174514310) has the molecular formula C12H12N6O2S
and a molecular weight of 304.34 g/mol. Its IUPAC name is N-phenyl-2H-triazole-4-sulfonamide;pyrimidine.
Molecular Properties
| Compound Name | N-phenyl-2H-triazole-4-sulfonamide;pyrimidine |
| PubChem CID | 174514310 |
| Molecular Formula | C12H12N6O2S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-phenyl-2H-triazole-4-sulfonamide;pyrimidine |
| SMILES | O=S(=O)(Nc1ccccc1)c1cn[nH]n1.c1cncnc1 |
| InChI | InChI=1S/C8H8N4O2S.C4H4N2/c13-15(14,8-6-9-12-10-8)11-7-4-2-1-3-5-7;1-2-5-4-6-3-1/h1-6,11H,(H,9,10,12);1-4H |
| InChIKey | OGCSMQVEBGQTIX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-phenyl-2H-triazole-4-sulfonamide;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-2H-triazole-4-sulfonamide;pyrimidine?
The IUPAC name of N-phenyl-2H-triazole-4-sulfonamide;pyrimidine (CID 174514310) is N-phenyl-2H-triazole-4-sulfonamide;pyrimidine.
What is the SMILES notation for N-phenyl-2H-triazole-4-sulfonamide;pyrimidine?
The canonical SMILES for N-phenyl-2H-triazole-4-sulfonamide;pyrimidine is O=S(=O)(Nc1ccccc1)c1cn[nH]n1.c1cncnc1.
What is the InChIKey of N-phenyl-2H-triazole-4-sulfonamide;pyrimidine?
The InChIKey is OGCSMQVEBGQTIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2S.C4H4N2/c13-15(14,8-6-9-12-10-8)11-7-4-2-1-3-5-7;1-2-5-4-6-3-1/h1-6,11H,(H,9,10,12);1-4H.
What are the key properties of N-phenyl-2H-triazole-4-sulfonamide;pyrimidine?
N-phenyl-2H-triazole-4-sulfonamide;pyrimidine has a molecular weight of 304.34 g/mol, XLogP of 1.08, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-2H-triazole-4-sulfonamide;pyrimidine is sourced from PubChem (CID 174514310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).