About calcium;hydride;2-phenylpropanedioic acid
calcium;hydride;2-phenylpropanedioic acid (PubChem CID 174516330) has the molecular formula C9H10CaO4
and a molecular weight of 222.25 g/mol. Its IUPAC name is calcium;hydride;2-phenylpropanedioic acid.
Molecular Properties
| Compound Name | calcium;hydride;2-phenylpropanedioic acid |
| PubChem CID | 174516330 |
| Molecular Formula | C9H10CaO4 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | calcium;hydride;2-phenylpropanedioic acid |
| SMILES | O=C(O)C(C(=O)O)c1ccccc1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C9H8O4.Ca.2H/c10-8(11)7(9(12)13)6-4-2-1-3-5-6;;;/h1-5,7H,(H,10,11)(H,12,13);;;/q;+2;2*-1 |
| InChIKey | ZYKGQWPEEQPUCS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;2-phenylpropanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;2-phenylpropanedioic acid?
The IUPAC name of calcium;hydride;2-phenylpropanedioic acid (CID 174516330) is calcium;hydride;2-phenylpropanedioic acid.
What is the SMILES notation for calcium;hydride;2-phenylpropanedioic acid?
The canonical SMILES for calcium;hydride;2-phenylpropanedioic acid is O=C(O)C(C(=O)O)c1ccccc1.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;2-phenylpropanedioic acid?
The InChIKey is ZYKGQWPEEQPUCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.Ca.2H/c10-8(11)7(9(12)13)6-4-2-1-3-5-6;;;/h1-5,7H,(H,10,11)(H,12,13);;;/q;+2;2*-1.
What are the key properties of calcium;hydride;2-phenylpropanedioic acid?
calcium;hydride;2-phenylpropanedioic acid has a molecular weight of 222.25 g/mol, XLogP of 0.78, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;2-phenylpropanedioic acid is sourced from PubChem (CID 174516330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).