About 3-cyclohexylprop-2-enoic acid;hydrochloride
3-cyclohexylprop-2-enoic acid;hydrochloride (PubChem CID 174517164) has the molecular formula C9H15ClO2
and a molecular weight of 190.67 g/mol. Its IUPAC name is 3-cyclohexylprop-2-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-cyclohexylprop-2-enoic acid;hydrochloride |
| PubChem CID | 174517164 |
| Molecular Formula | C9H15ClO2 |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 3-cyclohexylprop-2-enoic acid;hydrochloride |
| SMILES | Cl.O=C(O)C=CC1CCCCC1 |
| InChI | InChI=1S/C9H14O2.ClH/c10-9(11)7-6-8-4-2-1-3-5-8;/h6-8H,1-5H2,(H,10,11);1H |
| InChIKey | AGUBQDDXQGCWKQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexylprop-2-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylprop-2-enoic acid;hydrochloride?
The IUPAC name of 3-cyclohexylprop-2-enoic acid;hydrochloride (CID 174517164) is 3-cyclohexylprop-2-enoic acid;hydrochloride.
What is the SMILES notation for 3-cyclohexylprop-2-enoic acid;hydrochloride?
The canonical SMILES for 3-cyclohexylprop-2-enoic acid;hydrochloride is Cl.O=C(O)C=CC1CCCCC1.
What is the InChIKey of 3-cyclohexylprop-2-enoic acid;hydrochloride?
The InChIKey is AGUBQDDXQGCWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2.ClH/c10-9(11)7-6-8-4-2-1-3-5-8;/h6-8H,1-5H2,(H,10,11);1H.
What are the key properties of 3-cyclohexylprop-2-enoic acid;hydrochloride?
3-cyclohexylprop-2-enoic acid;hydrochloride has a molecular weight of 190.67 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylprop-2-enoic acid;hydrochloride is sourced from PubChem (CID 174517164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).