About 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine
2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine (PubChem CID 174517697) has the molecular formula C17H24F3NO
and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine |
| PubChem CID | 174517697 |
| Molecular Formula | C17H24F3NO |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine |
| SMILES | CCC(/C=N/c1cccc(C(F)(F)F)c1)COCC(C)(C)C |
| InChI | InChI=1S/C17H24F3NO/c1-5-13(11-22-12-16(2,3)4)10-21-15-8-6-7-14(9-15)17(18,19)20/h6-10,13H,5,11-12H2,1-4H3/b21-10+ |
| InChIKey | CXGMYYRDHBJHCJ-UFFVCSGVSA-N |
| XLogP | 5.50 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine?
The IUPAC name of 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine (CID 174517697) is 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine.
What is the SMILES notation for 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine?
The canonical SMILES for 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine is CCC(/C=N/c1cccc(C(F)(F)F)c1)COCC(C)(C)C.
What is the InChIKey of 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine?
The InChIKey is CXGMYYRDHBJHCJ-UFFVCSGVSA-N. The full InChI is InChI=1S/C17H24F3NO/c1-5-13(11-22-12-16(2,3)4)10-21-15-8-6-7-14(9-15)17(18,19)20/h6-10,13H,5,11-12H2,1-4H3/b21-10+.
What are the key properties of 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine?
2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine has a molecular weight of 315.38 g/mol, XLogP of 5.50, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropoxymethyl)-N-[3-(trifluoromethyl)phenyl]butan-1-imine is sourced from PubChem (CID 174517697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).