C30H27N3O2 — CID 174518662
2-[4-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]-3-phenyl-5,6-dihydro-1,6-naphthyridine-5-carbaldehyde (PubChem CID 174518662) has the molecular formula C30H27N3O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-[4-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]-3-phenyl-5,6-dihydro-1,6-naphthyridine-5-carbaldehyde.
| Compound Name | 2-[4-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]-3-phenyl-5,6-dihydro-1,6-naphthyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 174518662 |
| Molecular Formula | C30H27N3O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 2-[4-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]-3-phenyl-5,6-dihydro-1,6-naphthyridine-5-carbaldehyde |
| SMILES | O=CC1NC=Cc2nc(-c3ccc(CNCCc4ccc(O)cc4)cc3)c(-c3ccccc3)cc21 |
| InChI | InChI=1S/C30H27N3O2/c34-20-29-27-18-26(23-4-2-1-3-5-23)30(33-28(27)15-17-32-29)24-10-6-22(7-11-24)19-31-16-14-21-8-12-25(35)13-9-21/h1-13,15,17-18,20,29,31-32,35H,14,16,19H2 |
| InChIKey | RANRTIQUMONQTM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|