About 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate
1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate (PubChem CID 174518770) has the molecular formula C24H23F3N2O3
and a molecular weight of 444.45 g/mol. Its IUPAC name is 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate.
Molecular Properties
| Compound Name | 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate |
| PubChem CID | 174518770 |
| Molecular Formula | C24H23F3N2O3 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate |
| SMILES | CC(=O)OC(C)c1ccc(NC(=O)c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)cc1 |
| InChI | InChI=1S/C24H23F3N2O3/c1-14-13-20(15(2)29(14)22-8-6-5-7-21(22)24(25,26)27)23(31)28-19-11-9-18(10-12-19)16(3)32-17(4)30/h5-13,16H,1-4H3,(H,28,31) |
| InChIKey | AGLMRHDMGJJDGG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate?
The IUPAC name of 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate (CID 174518770) is 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate.
What is the SMILES notation for 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate?
The canonical SMILES for 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate is CC(=O)OC(C)c1ccc(NC(=O)c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)cc1.
What is the InChIKey of 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate?
The InChIKey is AGLMRHDMGJJDGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23F3N2O3/c1-14-13-20(15(2)29(14)22-8-6-5-7-21(22)24(25,26)27)23(31)28-19-11-9-18(10-12-19)16(3)32-17(4)30/h5-13,16H,1-4H3,(H,28,31).
What are the key properties of 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate?
1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate has a molecular weight of 444.45 g/mol, XLogP of 5.99, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]phenyl]ethyl acetate is sourced from PubChem (CID 174518770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).