About 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine
4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine (PubChem CID 174519058) has the molecular formula C25H26N2O2S
and a molecular weight of 418.56 g/mol. Its IUPAC name is 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine.
Molecular Properties
| Compound Name | 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine |
| PubChem CID | 174519058 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine |
| SMILES | CC1(C)c2c3c(ccc2=CCC1S(C)(=O)=O)=c1ccccc1=CC3.c1cnccn1 |
| InChI | InChI=1S/C21H22O2S.C4H4N2/c1-21(2)19(24(3,22)23)13-10-15-9-11-17-16-7-5-4-6-14(16)8-12-18(17)20(15)21;1-2-6-4-3-5-1/h4-11,19H,12-13H2,1-3H3;1-4H |
| InChIKey | PQSOMAPGUXDSLM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine?
The IUPAC name of 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine (CID 174519058) is 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine.
What is the SMILES notation for 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine?
The canonical SMILES for 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine is CC1(C)c2c3c(ccc2=CCC1S(C)(=O)=O)=c1ccccc1=CC3.c1cnccn1.
What is the InChIKey of 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine?
The InChIKey is PQSOMAPGUXDSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O2S.C4H4N2/c1-21(2)19(24(3,22)23)13-10-15-9-11-17-16-7-5-4-6-14(16)8-12-18(17)20(15)21;1-2-6-4-3-5-1/h4-11,19H,12-13H2,1-3H3;1-4H.
What are the key properties of 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine?
4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine has a molecular weight of 418.56 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-3-methylsulfonyl-3,5-dihydro-2H-chrysene;pyrazine is sourced from PubChem (CID 174519058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).