About 3,4-diethylborinin-2-amine
3,4-diethylborinin-2-amine (PubChem CID 174519135) has the molecular formula C9H14BN
and a molecular weight of 147.03 g/mol. Its IUPAC name is 3,4-diethylborinin-2-amine.
Molecular Properties
| Compound Name | 3,4-diethylborinin-2-amine |
| PubChem CID | 174519135 |
| Molecular Formula | C9H14BN |
| Molecular Weight | 147.03 g/mol |
| Exact Mass | 147.12 |
| IUPAC Name | 3,4-diethylborinin-2-amine |
| SMILES | CCc1ccbc(N)c1CC |
| InChI | InChI=1S/C9H14BN/c1-3-7-5-6-10-9(11)8(7)4-2/h5-6H,3-4,11H2,1-2H3 |
| InChIKey | DWPNVRVIZBFERC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.03 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-diethylborinin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethylborinin-2-amine?
The IUPAC name of 3,4-diethylborinin-2-amine (CID 174519135) is 3,4-diethylborinin-2-amine.
What is the SMILES notation for 3,4-diethylborinin-2-amine?
The canonical SMILES for 3,4-diethylborinin-2-amine is CCc1ccbc(N)c1CC.
What is the InChIKey of 3,4-diethylborinin-2-amine?
The InChIKey is DWPNVRVIZBFERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BN/c1-3-7-5-6-10-9(11)8(7)4-2/h5-6H,3-4,11H2,1-2H3.
What are the key properties of 3,4-diethylborinin-2-amine?
3,4-diethylborinin-2-amine has a molecular weight of 147.03 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethylborinin-2-amine is sourced from PubChem (CID 174519135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).