C8H18N2O — CID 174519195
2-(1,2-dimethylpiperazin-2-yl)ethanol (PubChem CID 174519195) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-(1,2-dimethylpiperazin-2-yl)ethanol.
| Compound Name | 2-(1,2-dimethylpiperazin-2-yl)ethanol |
|---|---|
| PubChem CID | 174519195 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 2-(1,2-dimethylpiperazin-2-yl)ethanol |
| SMILES | CN1CCNCC1(C)CCO |
| InChI | InChI=1S/C8H18N2O/c1-8(3-6-11)7-9-4-5-10(8)2/h9,11H,3-7H2,1-2H3 |
| InChIKey | ZYHCQWVPZBBOHI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |