C26H21NO9 — CID 174519744
4-ethylbenzene-1,3-dicarboxylic acid;ethyl 2-(2-nitrophenyl)-7-oxobicyclo[3.1.1]hepta-1,3,5-triene-3-carboxylate (PubChem CID 174519744) has the molecular formula C26H21NO9 and a molecular weight of 491.45 g/mol. Its IUPAC name is 4-ethylbenzene-1,3-dicarboxylic acid;ethyl 2-(2-nitrophenyl)-7-oxobicyclo[3.1.1]hepta-1,3,5-triene-3-carboxylate.
| Compound Name | 4-ethylbenzene-1,3-dicarboxylic acid;ethyl 2-(2-nitrophenyl)-7-oxobicyclo[3.1.1]hepta-1,3,5-triene-3-carboxylate |
|---|---|
| PubChem CID | 174519744 |
| Molecular Formula | C26H21NO9 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 4-ethylbenzene-1,3-dicarboxylic acid;ethyl 2-(2-nitrophenyl)-7-oxobicyclo[3.1.1]hepta-1,3,5-triene-3-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(c1-c1ccccc1[N+](=O)[O-])C2=O.CCc1ccc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C16H11NO5.C10H10O4/c1-2-22-16(19)12-8-9-7-11(15(9)18)14(12)10-5-3-4-6-13(10)17(20)21;1-2-6-3-4-7(9(11)12)5-8(6)10(13)14/h3-8H,2H2,1H3;3-5H,2H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | UHJSNUUSLNONEP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 161.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|