C12H14NO5S- — CID 174520315
[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-methylamino] sulfite (PubChem CID 174520315) has the molecular formula C12H14NO5S- and a molecular weight of 284.31 g/mol. Its IUPAC name is [[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-methylamino] sulfite.
| Compound Name | [[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-methylamino] sulfite |
|---|---|
| PubChem CID | 174520315 |
| Molecular Formula | C12H14NO5S- |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | [[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-methylamino] sulfite |
| SMILES | CN(OS(=O)[O-])C(C1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C12H15NO5S/c1-13(18-19(14)15)12(10-5-3-2-4-6-10)11-9-16-7-8-17-11/h2-3,5,7-9,12H,4,6H2,1H3,(H,14,15)/p-1 |
| InChIKey | FFETUGDADUVIJQ-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|