C12H15NO5S — CID 174520316
[[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-methylamino] hydrogen sulfite (PubChem CID 174520316) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is [[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-methylamino] hydrogen sulfite.
| Compound Name | [[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-methylamino] hydrogen sulfite |
|---|---|
| PubChem CID | 174520316 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | [[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-methylamino] hydrogen sulfite |
| SMILES | CN(OS(=O)O)C(C1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C12H15NO5S/c1-13(18-19(14)15)12(10-5-3-2-4-6-10)11-9-16-7-8-17-11/h2-3,5,7-9,12H,4,6H2,1H3,(H,14,15) |
| InChIKey | FFETUGDADUVIJQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|