C11H12NO4S- — CID 174520412
2-[(S)-cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine (PubChem CID 174520412) has the molecular formula C11H12NO4S- and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[(S)-cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine.
| Compound Name | 2-[(S)-cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine |
|---|---|
| PubChem CID | 174520412 |
| Molecular Formula | C11H12NO4S- |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-[(S)-cyclohexa-1,3-dien-1-yl-(sulfinatoamino)methyl]-1,4-dioxine |
| SMILES | O=S([O-])N[C@@H](C1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C11H13NO4S/c13-17(14)12-11(9-4-2-1-3-5-9)10-8-15-6-7-16-10/h1-2,4,6-8,11-12H,3,5H2,(H,13,14)/p-1/t11-/m0/s1 |
| InChIKey | AODQYPSQWAVINN-NSHDSACASA-M |
| XLogP | 1.37 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|