C12H10ClN5O — CID 17452054
6-(4-chloro-3-ethylphenoxy)tetrazolo[1,5-b]pyridazine (PubChem CID 17452054) has the molecular formula C12H10ClN5O and a molecular weight of 275.70 g/mol. Its IUPAC name is 6-(4-chloro-3-ethylphenoxy)tetrazolo[1,5-b]pyridazine.
| Compound Name | 6-(4-chloro-3-ethylphenoxy)tetrazolo[1,5-b]pyridazine |
|---|---|
| PubChem CID | 17452054 |
| Molecular Formula | C12H10ClN5O |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 6-(4-chloro-3-ethylphenoxy)tetrazolo[1,5-b]pyridazine |
| SMILES | CCc1cc(Oc2ccc3nnnn3n2)ccc1Cl |
| InChI | InChI=1S/C12H10ClN5O/c1-2-8-7-9(3-4-10(8)13)19-12-6-5-11-14-16-17-18(11)15-12/h3-7H,2H2,1H3 |
| InChIKey | YLBGTNGOPIKPAT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |