About 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine
5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine (PubChem CID 17452059) has the molecular formula C16H9N7S2
and a molecular weight of 363.43 g/mol. Its IUPAC name is 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine |
| PubChem CID | 17452059 |
| Molecular Formula | C16H9N7S2 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine |
| SMILES | c1ccc(-c2csc3ncnc(Sc4ccc5nnnn5n4)c23)cc1 |
| InChI | InChI=1S/C16H9N7S2/c1-2-4-10(5-3-1)11-8-24-15-14(11)16(18-9-17-15)25-13-7-6-12-19-21-22-23(12)20-13/h1-9H |
| InChIKey | JYAJAWAECOQFNB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine?
The IUPAC name of 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine (CID 17452059) is 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine.
What is the SMILES notation for 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine?
The canonical SMILES for 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine is c1ccc(-c2csc3ncnc(Sc4ccc5nnnn5n4)c23)cc1.
What is the InChIKey of 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine?
The InChIKey is JYAJAWAECOQFNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N7S2/c1-2-4-10(5-3-1)11-8-24-15-14(11)16(18-9-17-15)25-13-7-6-12-19-21-22-23(12)20-13/h1-9H.
What are the key properties of 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine?
5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine has a molecular weight of 363.43 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-4-(tetrazolo[1,5-b]pyridazin-6-ylsulfanyl)thieno[2,3-d]pyrimidine is sourced from PubChem (CID 17452059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).