C13H16ClNO4S — CID 174520992
1-amino-2-(4-chlorophenyl)-2,4-dimethyl-3-oxopent-4-ene-1-sulfonic acid (PubChem CID 174520992) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is 1-amino-2-(4-chlorophenyl)-2,4-dimethyl-3-oxopent-4-ene-1-sulfonic acid.
| Compound Name | 1-amino-2-(4-chlorophenyl)-2,4-dimethyl-3-oxopent-4-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 174520992 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-amino-2-(4-chlorophenyl)-2,4-dimethyl-3-oxopent-4-ene-1-sulfonic acid |
| SMILES | C=C(C)C(=O)C(C)(c1ccc(Cl)cc1)C(N)S(=O)(=O)O |
| InChI | InChI=1S/C13H16ClNO4S/c1-8(2)11(16)13(3,12(15)20(17,18)19)9-4-6-10(14)7-5-9/h4-7,12H,1,15H2,2-3H3,(H,17,18,19) |
| InChIKey | JKPKNGDBMLDNMN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|