About sodium;ethyl N-ethylsulfamate;hydride
sodium;ethyl N-ethylsulfamate;hydride (PubChem CID 174521414) has the molecular formula C4H12NNaO3S
and a molecular weight of 177.20 g/mol. Its IUPAC name is sodium;ethyl N-ethylsulfamate;hydride.
Molecular Properties
| Compound Name | sodium;ethyl N-ethylsulfamate;hydride |
| PubChem CID | 174521414 |
| Molecular Formula | C4H12NNaO3S |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | sodium;ethyl N-ethylsulfamate;hydride |
| SMILES | CCNS(=O)(=O)OCC.[H-].[Na+] |
| InChI | InChI=1S/C4H11NO3S.Na.H/c1-3-5-9(6,7)8-4-2;;/h5H,3-4H2,1-2H3;;/q;+1;-1 |
| InChIKey | ZRIGETZFEXHJOM-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;ethyl N-ethylsulfamate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethyl N-ethylsulfamate;hydride?
The IUPAC name of sodium;ethyl N-ethylsulfamate;hydride (CID 174521414) is sodium;ethyl N-ethylsulfamate;hydride.
What is the SMILES notation for sodium;ethyl N-ethylsulfamate;hydride?
The canonical SMILES for sodium;ethyl N-ethylsulfamate;hydride is CCNS(=O)(=O)OCC.[H-].[Na+].
What is the InChIKey of sodium;ethyl N-ethylsulfamate;hydride?
The InChIKey is ZRIGETZFEXHJOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO3S.Na.H/c1-3-5-9(6,7)8-4-2;;/h5H,3-4H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;ethyl N-ethylsulfamate;hydride?
sodium;ethyl N-ethylsulfamate;hydride has a molecular weight of 177.20 g/mol, XLogP of -3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethyl N-ethylsulfamate;hydride is sourced from PubChem (CID 174521414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).