About calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine
calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine (PubChem CID 174521713) has the molecular formula C7H9CaN3O
and a molecular weight of 191.25 g/mol. Its IUPAC name is calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 174521713 |
| Molecular Formula | C7H9CaN3O |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine |
| SMILES | COc1nc2ncccc2[nH]1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C7H7N3O.Ca.2H/c1-11-7-9-5-3-2-4-8-6(5)10-7;;;/h2-4H,1H3,(H,8,9,10);;;/q;+2;2*-1 |
| InChIKey | BQCPDWYFZHKOCN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine?
The IUPAC name of calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine (CID 174521713) is calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine is COc1nc2ncccc2[nH]1.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine?
The InChIKey is BQCPDWYFZHKOCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O.Ca.2H/c1-11-7-9-5-3-2-4-8-6(5)10-7;;;/h2-4H,1H3,(H,8,9,10);;;/q;+2;2*-1.
What are the key properties of calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine?
calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine has a molecular weight of 191.25 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;2-methoxy-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 174521713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).