C20H18Br2 — CID 174521774
1,2-dibromo-1,2,3,4-tetrahydrochrysene;ethene (PubChem CID 174521774) has the molecular formula C20H18Br2 and a molecular weight of 418.17 g/mol. Its IUPAC name is 1,2-dibromo-1,2,3,4-tetrahydrochrysene;ethene.
| Compound Name | 1,2-dibromo-1,2,3,4-tetrahydrochrysene;ethene |
|---|---|
| PubChem CID | 174521774 |
| Molecular Formula | C20H18Br2 |
| Molecular Weight | 418.17 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | 1,2-dibromo-1,2,3,4-tetrahydrochrysene;ethene |
| SMILES | BrC1CCc2c(ccc3c2ccc2ccccc23)C1Br.C=C |
| InChI | InChI=1S/C18H14Br2.C2H4/c19-17-10-9-15-14-6-5-11-3-1-2-4-12(11)13(14)7-8-16(15)18(17)20;1-2/h1-8,17-18H,9-10H2;1-2H2 |
| InChIKey | ZKYKIDQMGWQUES-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.17 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|