About 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine
4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine (PubChem CID 174521796) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine.
Molecular Properties
| Compound Name | 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine |
| PubChem CID | 174521796 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine |
| SMILES | CNC.NC(=O)c1ccc(C(=O)n2c3ccc2cc3)cc1 |
| InChI | InChI=1S/C14H10N2O2.C2H7N/c15-13(17)9-1-3-10(4-2-9)14(18)16-11-5-6-12(16)8-7-11;1-3-2/h1-8H,(H2,15,17);3H,1-2H3 |
| InChIKey | WVTJKJXISBCHJW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine?
The IUPAC name of 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine (CID 174521796) is 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine.
What is the SMILES notation for 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine?
The canonical SMILES for 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine is CNC.NC(=O)c1ccc(C(=O)n2c3ccc2cc3)cc1.
What is the InChIKey of 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine?
The InChIKey is WVTJKJXISBCHJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2.C2H7N/c15-13(17)9-1-3-10(4-2-9)14(18)16-11-5-6-12(16)8-7-11;1-3-2/h1-8H,(H2,15,17);3H,1-2H3.
What are the key properties of 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine?
4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine has a molecular weight of 283.33 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide;N-methylmethanamine is sourced from PubChem (CID 174521796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).