About 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide
2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide (PubChem CID 174522837) has the molecular formula C11H11N3OS
and a molecular weight of 233.30 g/mol. Its IUPAC name is 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide.
Molecular Properties
| Compound Name | 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide |
| PubChem CID | 174522837 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide |
| SMILES | Cc1nsc(N)c1-c1ccccc1C(N)=O |
| InChI | InChI=1S/C11H11N3OS/c1-6-9(11(13)16-14-6)7-4-2-3-5-8(7)10(12)15/h2-5H,13H2,1H3,(H2,12,15) |
| InChIKey | WIHIBIVNSMAOCO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide?
The IUPAC name of 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide (CID 174522837) is 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide.
What is the SMILES notation for 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide?
The canonical SMILES for 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide is Cc1nsc(N)c1-c1ccccc1C(N)=O.
What is the InChIKey of 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide?
The InChIKey is WIHIBIVNSMAOCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3OS/c1-6-9(11(13)16-14-6)7-4-2-3-5-8(7)10(12)15/h2-5H,13H2,1H3,(H2,12,15).
What are the key properties of 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide?
2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide has a molecular weight of 233.30 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-3-methyl-1,2-thiazol-4-yl)benzamide is sourced from PubChem (CID 174522837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).