About piperidine;1H-pyrimidine-2,4-dione
piperidine;1H-pyrimidine-2,4-dione (PubChem CID 174523107) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is piperidine;1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | piperidine;1H-pyrimidine-2,4-dione |
| PubChem CID | 174523107 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | piperidine;1H-pyrimidine-2,4-dione |
| SMILES | C1CCNCC1.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H11N.C4H4N2O2/c1-2-4-6-5-3-1;7-3-1-2-5-4(8)6-3/h6H,1-5H2;1-2H,(H2,5,6,7,8) |
| InChIKey | VMZKAYAYOPWXDV-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidine;1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine;1H-pyrimidine-2,4-dione?
The IUPAC name of piperidine;1H-pyrimidine-2,4-dione (CID 174523107) is piperidine;1H-pyrimidine-2,4-dione.
What is the SMILES notation for piperidine;1H-pyrimidine-2,4-dione?
The canonical SMILES for piperidine;1H-pyrimidine-2,4-dione is C1CCNCC1.O=c1cc[nH]c(=O)[nH]1.
What is the InChIKey of piperidine;1H-pyrimidine-2,4-dione?
The InChIKey is VMZKAYAYOPWXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.C4H4N2O2/c1-2-4-6-5-3-1;7-3-1-2-5-4(8)6-3/h6H,1-5H2;1-2H,(H2,5,6,7,8).
What are the key properties of piperidine;1H-pyrimidine-2,4-dione?
piperidine;1H-pyrimidine-2,4-dione has a molecular weight of 197.24 g/mol, XLogP of -0.18, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;1H-pyrimidine-2,4-dione is sourced from PubChem (CID 174523107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).