About N-(dimethylhydrazinylidene)formamide;dihydrochloride
N-(dimethylhydrazinylidene)formamide;dihydrochloride (PubChem CID 174523458) has the molecular formula C3H9Cl2N3O
and a molecular weight of 174.03 g/mol. Its IUPAC name is N-(dimethylhydrazinylidene)formamide;dihydrochloride.
Molecular Properties
| Compound Name | N-(dimethylhydrazinylidene)formamide;dihydrochloride |
| PubChem CID | 174523458 |
| Molecular Formula | C3H9Cl2N3O |
| Molecular Weight | 174.03 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | N-(dimethylhydrazinylidene)formamide;dihydrochloride |
| SMILES | CN(C)/N=N/C=O.Cl.Cl |
| InChI | InChI=1S/C3H7N3O.2ClH/c1-6(2)5-4-3-7;;/h3H,1-2H3;2*1H/b5-4+;; |
| InChIKey | VXFMZCPVEKRCTC-SFKRKKMESA-N |
| XLogP | 0.92 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.03 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(dimethylhydrazinylidene)formamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(dimethylhydrazinylidene)formamide;dihydrochloride?
The IUPAC name of N-(dimethylhydrazinylidene)formamide;dihydrochloride (CID 174523458) is N-(dimethylhydrazinylidene)formamide;dihydrochloride.
What is the SMILES notation for N-(dimethylhydrazinylidene)formamide;dihydrochloride?
The canonical SMILES for N-(dimethylhydrazinylidene)formamide;dihydrochloride is CN(C)/N=N/C=O.Cl.Cl.
What is the InChIKey of N-(dimethylhydrazinylidene)formamide;dihydrochloride?
The InChIKey is VXFMZCPVEKRCTC-SFKRKKMESA-N. The full InChI is InChI=1S/C3H7N3O.2ClH/c1-6(2)5-4-3-7;;/h3H,1-2H3;2*1H/b5-4+;;.
What are the key properties of N-(dimethylhydrazinylidene)formamide;dihydrochloride?
N-(dimethylhydrazinylidene)formamide;dihydrochloride has a molecular weight of 174.03 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(dimethylhydrazinylidene)formamide;dihydrochloride is sourced from PubChem (CID 174523458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).