About 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile
1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile (PubChem CID 174524003) has the molecular formula C25H24FNO3
and a molecular weight of 405.47 g/mol. Its IUPAC name is 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile.
Molecular Properties
| Compound Name | 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile |
| PubChem CID | 174524003 |
| Molecular Formula | C25H24FNO3 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile |
| SMILES | N#Cc1ccccc1F.O=C(O)C1(OC2CCCC2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C18H20O3.C7H4FN/c19-17(20)18(21-16-8-4-5-9-16)12-10-15(11-13-18)14-6-2-1-3-7-14;8-7-4-2-1-3-6(7)5-9/h1-3,6-7,10-12,16H,4-5,8-9,13H2,(H,19,20);1-4H |
| InChIKey | MKGZGMUZCCHEFJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile?
The IUPAC name of 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile (CID 174524003) is 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile.
What is the SMILES notation for 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile?
The canonical SMILES for 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile is N#Cc1ccccc1F.O=C(O)C1(OC2CCCC2)C=CC(c2ccccc2)=CC1.
What is the InChIKey of 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile?
The InChIKey is MKGZGMUZCCHEFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O3.C7H4FN/c19-17(20)18(21-16-8-4-5-9-16)12-10-15(11-13-18)14-6-2-1-3-7-14;8-7-4-2-1-3-6(7)5-9/h1-3,6-7,10-12,16H,4-5,8-9,13H2,(H,19,20);1-4H.
What are the key properties of 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile?
1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile has a molecular weight of 405.47 g/mol, XLogP of 5.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyloxy-4-phenylcyclohexa-2,4-diene-1-carboxylic acid;2-fluorobenzonitrile is sourced from PubChem (CID 174524003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).