About 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine
6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 174524150) has the molecular formula C13H8F3N5
and a molecular weight of 291.24 g/mol. Its IUPAC name is 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine |
| PubChem CID | 174524150 |
| Molecular Formula | C13H8F3N5 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)Nc1cc(-c2ccc3cccnc3n2)ncn1 |
| InChI | InChI=1S/C13H8F3N5/c14-13(15,16)21-11-6-10(18-7-19-11)9-4-3-8-2-1-5-17-12(8)20-9/h1-7H,(H,18,19,21) |
| InChIKey | LXYKBQMJEVRLAC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine?
The IUPAC name of 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine (CID 174524150) is 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine.
What is the SMILES notation for 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine?
The canonical SMILES for 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine is FC(F)(F)Nc1cc(-c2ccc3cccnc3n2)ncn1.
What is the InChIKey of 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine?
The InChIKey is LXYKBQMJEVRLAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F3N5/c14-13(15,16)21-11-6-10(18-7-19-11)9-4-3-8-2-1-5-17-12(8)20-9/h1-7H,(H,18,19,21).
What are the key properties of 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine?
6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine has a molecular weight of 291.24 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,8-naphthyridin-2-yl)-N-(trifluoromethyl)pyrimidin-4-amine is sourced from PubChem (CID 174524150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).