About 4-(dimethylamino)butanoic acid;molecular chlorine
4-(dimethylamino)butanoic acid;molecular chlorine (PubChem CID 174526336) has the molecular formula C6H13Cl2NO2
and a molecular weight of 202.08 g/mol. Its IUPAC name is 4-(dimethylamino)butanoic acid;molecular chlorine.
Molecular Properties
| Compound Name | 4-(dimethylamino)butanoic acid;molecular chlorine |
| PubChem CID | 174526336 |
| Molecular Formula | C6H13Cl2NO2 |
| Molecular Weight | 202.08 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | 4-(dimethylamino)butanoic acid;molecular chlorine |
| SMILES | CN(C)CCCC(=O)O.ClCl |
| InChI | InChI=1S/C6H13NO2.Cl2/c1-7(2)5-3-4-6(8)9;1-2/h3-5H2,1-2H3,(H,8,9); |
| InChIKey | XPOXLOWPONXDCR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.08 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(dimethylamino)butanoic acid;molecular chlorine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)butanoic acid;molecular chlorine?
The IUPAC name of 4-(dimethylamino)butanoic acid;molecular chlorine (CID 174526336) is 4-(dimethylamino)butanoic acid;molecular chlorine.
What is the SMILES notation for 4-(dimethylamino)butanoic acid;molecular chlorine?
The canonical SMILES for 4-(dimethylamino)butanoic acid;molecular chlorine is CN(C)CCCC(=O)O.ClCl.
What is the InChIKey of 4-(dimethylamino)butanoic acid;molecular chlorine?
The InChIKey is XPOXLOWPONXDCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2.Cl2/c1-7(2)5-3-4-6(8)9;1-2/h3-5H2,1-2H3,(H,8,9);.
What are the key properties of 4-(dimethylamino)butanoic acid;molecular chlorine?
4-(dimethylamino)butanoic acid;molecular chlorine has a molecular weight of 202.08 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)butanoic acid;molecular chlorine is sourced from PubChem (CID 174526336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).