C11H14N4O3S2 — CID 174526396
2,4-bis(2-amino-1,3-thiazol-4-yl)-1,5-dihydroxypentan-3-one (PubChem CID 174526396) has the molecular formula C11H14N4O3S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2,4-bis(2-amino-1,3-thiazol-4-yl)-1,5-dihydroxypentan-3-one.
| Compound Name | 2,4-bis(2-amino-1,3-thiazol-4-yl)-1,5-dihydroxypentan-3-one |
|---|---|
| PubChem CID | 174526396 |
| Molecular Formula | C11H14N4O3S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2,4-bis(2-amino-1,3-thiazol-4-yl)-1,5-dihydroxypentan-3-one |
| SMILES | Nc1nc(C(CO)C(=O)C(CO)c2csc(N)n2)cs1 |
| InChI | InChI=1S/C11H14N4O3S2/c12-10-14-7(3-19-10)5(1-16)9(18)6(2-17)8-4-20-11(13)15-8/h3-6,16-17H,1-2H2,(H2,12,14)(H2,13,15) |
| InChIKey | BBUODJCPZDXQTG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |