C22H16ClF3N2O2 — CID 174526541
7-chloro-5-pyridin-3-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-dihydroisoindole-1-carbaldehyde (PubChem CID 174526541) has the molecular formula C22H16ClF3N2O2 and a molecular weight of 432.83 g/mol. Its IUPAC name is 7-chloro-5-pyridin-3-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-dihydroisoindole-1-carbaldehyde.
| Compound Name | 7-chloro-5-pyridin-3-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-dihydroisoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174526541 |
| Molecular Formula | C22H16ClF3N2O2 |
| Molecular Weight | 432.83 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 7-chloro-5-pyridin-3-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-dihydroisoindole-1-carbaldehyde |
| SMILES | O=CC1c2c(Cl)cc(-c3cccnc3)cc2CN1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H16ClF3N2O2/c23-19-9-16(15-2-1-7-27-10-15)8-17-12-28(20(13-29)21(17)19)11-14-3-5-18(6-4-14)30-22(24,25)26/h1-10,13,20H,11-12H2 |
| InChIKey | AZOGRIWGQVLJKQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.83 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|