C45H44F2N4O — CID 174526611
2,4-bis(6-butanimidoyl-2-methyl-4-phenylquinolin-3-yl)-1,5-difluoropentan-3-one (PubChem CID 174526611) has the molecular formula C45H44F2N4O and a molecular weight of 694.87 g/mol. Its IUPAC name is 2,4-bis(6-butanimidoyl-2-methyl-4-phenylquinolin-3-yl)-1,5-difluoropentan-3-one.
| Compound Name | 2,4-bis(6-butanimidoyl-2-methyl-4-phenylquinolin-3-yl)-1,5-difluoropentan-3-one |
|---|---|
| PubChem CID | 174526611 |
| Molecular Formula | C45H44F2N4O |
| Molecular Weight | 694.87 g/mol |
| Exact Mass | 694.35 |
| IUPAC Name | 2,4-bis(6-butanimidoyl-2-methyl-4-phenylquinolin-3-yl)-1,5-difluoropentan-3-one |
| SMILES | [H]/N=C(\CCC)c1ccc2nc(C)c(C(CF)C(=O)C(CF)c3c(C)nc4ccc(/C(CCC)=N/[H])cc4c3-c3ccccc3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C45H44F2N4O/c1-5-13-37(48)31-19-21-39-33(23-31)43(29-15-9-7-10-16-29)41(27(3)50-39)35(25-46)45(52)36(26-47)42-28(4)51-40-22-20-32(38(49)14-6-2)24-34(40)44(42)30-17-11-8-12-18-30/h7-12,15-24,35-36,48-49H,5-6,13-14,25-26H2,1-4H3/b48-37+,49-38+ |
| InChIKey | BSZPFEKRSZSCNE-XWQCQBFISA-N |
| XLogP | 11.45 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.87 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|