C15H19BrClNO — CID 174527110
6-bromo-5-chloro-2,2,4,4,8-pentamethyl-1,3-dihydroquinoline-3-carbaldehyde (PubChem CID 174527110) has the molecular formula C15H19BrClNO and a molecular weight of 344.68 g/mol. Its IUPAC name is 6-bromo-5-chloro-2,2,4,4,8-pentamethyl-1,3-dihydroquinoline-3-carbaldehyde.
| Compound Name | 6-bromo-5-chloro-2,2,4,4,8-pentamethyl-1,3-dihydroquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 174527110 |
| Molecular Formula | C15H19BrClNO |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 6-bromo-5-chloro-2,2,4,4,8-pentamethyl-1,3-dihydroquinoline-3-carbaldehyde |
| SMILES | Cc1cc(Br)c(Cl)c2c1NC(C)(C)C(C=O)C2(C)C |
| InChI | InChI=1S/C15H19BrClNO/c1-8-6-9(16)12(17)11-13(8)18-15(4,5)10(7-19)14(11,2)3/h6-7,10,18H,1-5H3 |
| InChIKey | OQUKXZQCYXMVAS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|