About 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine
2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine (PubChem CID 174527181) has the molecular formula C11H8Cl2N2
and a molecular weight of 239.11 g/mol. Its IUPAC name is 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine.
Molecular Properties
| Compound Name | 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine |
| PubChem CID | 174527181 |
| Molecular Formula | C11H8Cl2N2 |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine |
| SMILES | Clc1cccc2c1C2.Clc1ccncn1 |
| InChI | InChI=1S/C7H5Cl.C4H3ClN2/c8-7-3-1-2-5-4-6(5)7;5-4-1-2-6-3-7-4/h1-3H,4H2;1-3H |
| InChIKey | JJGDQIKPSGNSGP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine?
The IUPAC name of 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine (CID 174527181) is 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine.
What is the SMILES notation for 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine?
The canonical SMILES for 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine is Clc1cccc2c1C2.Clc1ccncn1.
What is the InChIKey of 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine?
The InChIKey is JJGDQIKPSGNSGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl.C4H3ClN2/c8-7-3-1-2-5-4-6(5)7;5-4-1-2-6-3-7-4/h1-3H,4H2;1-3H.
What are the key properties of 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine?
2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine has a molecular weight of 239.11 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobicyclo[4.1.0]hepta-1(6),2,4-triene;4-chloropyrimidine is sourced from PubChem (CID 174527181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).