About 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane
3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane (PubChem CID 174527214) has the molecular formula C12H27NO4Si2
and a molecular weight of 305.52 g/mol. Its IUPAC name is 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane.
Molecular Properties
| Compound Name | 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane |
| PubChem CID | 174527214 |
| Molecular Formula | C12H27NO4Si2 |
| Molecular Weight | 305.52 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane |
| SMILES | CCCC1(OC)C(N=C=O)CCC[Si]1(OC)OC.[SiH4] |
| InChI | InChI=1S/C12H23NO4Si.H4Si/c1-5-8-12(15-2)11(13-10-14)7-6-9-18(12,16-3)17-4;/h11H,5-9H2,1-4H3;1H4 |
| InChIKey | IQJNMLCRFDKDTE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.52 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane?
The IUPAC name of 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane (CID 174527214) is 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane.
What is the SMILES notation for 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane?
The canonical SMILES for 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane is CCCC1(OC)C(N=C=O)CCC[Si]1(OC)OC.[SiH4].
What is the InChIKey of 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane?
The InChIKey is IQJNMLCRFDKDTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO4Si.H4Si/c1-5-8-12(15-2)11(13-10-14)7-6-9-18(12,16-3)17-4;/h11H,5-9H2,1-4H3;1H4.
What are the key properties of 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane?
3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane has a molecular weight of 305.52 g/mol, XLogP of 0.49, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane;silane is sourced from PubChem (CID 174527214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).