C25H23FN4O3 — CID 174527524
2-[4-[[4-[fluoro-[3-(2H-tetrazol-5-yl)phenyl]methyl]phenyl]methoxy]-2-hydroxy-3-methylphenyl]propanal (PubChem CID 174527524) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is 2-[4-[[4-[fluoro-[3-(2H-tetrazol-5-yl)phenyl]methyl]phenyl]methoxy]-2-hydroxy-3-methylphenyl]propanal.
| Compound Name | 2-[4-[[4-[fluoro-[3-(2H-tetrazol-5-yl)phenyl]methyl]phenyl]methoxy]-2-hydroxy-3-methylphenyl]propanal |
|---|---|
| PubChem CID | 174527524 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[4-[[4-[fluoro-[3-(2H-tetrazol-5-yl)phenyl]methyl]phenyl]methoxy]-2-hydroxy-3-methylphenyl]propanal |
| SMILES | Cc1c(OCc2ccc(C(F)c3cccc(-c4nn[nH]n4)c3)cc2)ccc(C(C)C=O)c1O |
| InChI | InChI=1S/C25H23FN4O3/c1-15(13-31)21-10-11-22(16(2)24(21)32)33-14-17-6-8-18(9-7-17)23(26)19-4-3-5-20(12-19)25-27-29-30-28-25/h3-13,15,23,32H,14H2,1-2H3,(H,27,28,29,30) |
| InChIKey | OJPQZZMMSHRLQJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|