About 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate
1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate (PubChem CID 174527584) has the molecular formula C19H16Cl2O7
and a molecular weight of 427.24 g/mol. Its IUPAC name is 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate.
Molecular Properties
| Compound Name | 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate |
| PubChem CID | 174527584 |
| Molecular Formula | C19H16Cl2O7 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate |
| SMILES | COC(C)=O.Clc1cccc(-c2ccccc2)c1Cl.O=CC(=O)OC(=O)C=O |
| InChI | InChI=1S/C12H8Cl2.C4H2O5.C3H6O2/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;5-1-3(7)9-4(8)2-6;1-3(4)5-2/h1-8H;1-2H;1-2H3 |
| InChIKey | RSMOVIHNKUGRMK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate?
The IUPAC name of 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate (CID 174527584) is 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate.
What is the SMILES notation for 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate?
The canonical SMILES for 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate is COC(C)=O.Clc1cccc(-c2ccccc2)c1Cl.O=CC(=O)OC(=O)C=O.
What is the InChIKey of 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate?
The InChIKey is RSMOVIHNKUGRMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2.C4H2O5.C3H6O2/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;5-1-3(7)9-4(8)2-6;1-3(4)5-2/h1-8H;1-2H;1-2H3.
What are the key properties of 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate?
1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate has a molecular weight of 427.24 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-3-phenylbenzene;methyl acetate;oxaldehydoyl 2-oxoacetate is sourced from PubChem (CID 174527584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).