C20H13N3O2S — CID 174528257
6-[[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]-4-phenylquinoline-3-carbonitrile (PubChem CID 174528257) has the molecular formula C20H13N3O2S and a molecular weight of 359.41 g/mol. Its IUPAC name is 6-[[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]-4-phenylquinoline-3-carbonitrile.
| Compound Name | 6-[[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]-4-phenylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 174528257 |
| Molecular Formula | C20H13N3O2S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 6-[[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]-4-phenylquinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccc(C[C@H]3SC(=O)NC3=O)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C20H13N3O2S/c21-10-14-11-22-16-7-6-12(9-17-19(24)23-20(25)26-17)8-15(16)18(14)13-4-2-1-3-5-13/h1-8,11,17H,9H2,(H,23,24,25)/t17-/m1/s1 |
| InChIKey | SOMPHWTZBSHNKH-QGZVFWFLSA-N |
| XLogP | 3.67 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|