About hexan-3-ol;thiophene
hexan-3-ol;thiophene (PubChem CID 174528278) has the molecular formula C10H18OS
and a molecular weight of 186.32 g/mol. Its IUPAC name is hexan-3-ol;thiophene.
Molecular Properties
| Compound Name | hexan-3-ol;thiophene |
| PubChem CID | 174528278 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | hexan-3-ol;thiophene |
| SMILES | CCCC(O)CC.c1ccsc1 |
| InChI | InChI=1S/C6H14O.C4H4S/c1-3-5-6(7)4-2;1-2-4-5-3-1/h6-7H,3-5H2,1-2H3;1-4H |
| InChIKey | IPZVOKANQJVGAD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hexan-3-ol;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-3-ol;thiophene?
The IUPAC name of hexan-3-ol;thiophene (CID 174528278) is hexan-3-ol;thiophene.
What is the SMILES notation for hexan-3-ol;thiophene?
The canonical SMILES for hexan-3-ol;thiophene is CCCC(O)CC.c1ccsc1.
What is the InChIKey of hexan-3-ol;thiophene?
The InChIKey is IPZVOKANQJVGAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C4H4S/c1-3-5-6(7)4-2;1-2-4-5-3-1/h6-7H,3-5H2,1-2H3;1-4H.
What are the key properties of hexan-3-ol;thiophene?
hexan-3-ol;thiophene has a molecular weight of 186.32 g/mol, XLogP of 3.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-3-ol;thiophene is sourced from PubChem (CID 174528278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).