About bis(formyloxymethyl) 2-hydroxybutanedioate
bis(formyloxymethyl) 2-hydroxybutanedioate (PubChem CID 174529204) has the molecular formula C8H10O9
and a molecular weight of 250.16 g/mol. Its IUPAC name is bis(formyloxymethyl) 2-hydroxybutanedioate.
Molecular Properties
| Compound Name | bis(formyloxymethyl) 2-hydroxybutanedioate |
| PubChem CID | 174529204 |
| Molecular Formula | C8H10O9 |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | bis(formyloxymethyl) 2-hydroxybutanedioate |
| SMILES | O=COCOC(=O)CC(O)C(=O)OCOC=O |
| InChI | InChI=1S/C8H10O9/c9-2-14-4-16-7(12)1-6(11)8(13)17-5-15-3-10/h2-3,6,11H,1,4-5H2 |
| InChIKey | HNAGWHCGWKZSIQ-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(formyloxymethyl) 2-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(formyloxymethyl) 2-hydroxybutanedioate?
The IUPAC name of bis(formyloxymethyl) 2-hydroxybutanedioate (CID 174529204) is bis(formyloxymethyl) 2-hydroxybutanedioate.
What is the SMILES notation for bis(formyloxymethyl) 2-hydroxybutanedioate?
The canonical SMILES for bis(formyloxymethyl) 2-hydroxybutanedioate is O=COCOC(=O)CC(O)C(=O)OCOC=O.
What is the InChIKey of bis(formyloxymethyl) 2-hydroxybutanedioate?
The InChIKey is HNAGWHCGWKZSIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O9/c9-2-14-4-16-7(12)1-6(11)8(13)17-5-15-3-10/h2-3,6,11H,1,4-5H2.
What are the key properties of bis(formyloxymethyl) 2-hydroxybutanedioate?
bis(formyloxymethyl) 2-hydroxybutanedioate has a molecular weight of 250.16 g/mol, XLogP of -1.92, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(formyloxymethyl) 2-hydroxybutanedioate is sourced from PubChem (CID 174529204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).