About 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene
5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene (PubChem CID 174529615) has the molecular formula C16H19BrO2
and a molecular weight of 323.23 g/mol. Its IUPAC name is 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene |
| PubChem CID | 174529615 |
| Molecular Formula | C16H19BrO2 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene |
| SMILES | COC1=CC=C(c2ccccc2)CC1(CCBr)OC |
| InChI | InChI=1S/C16H19BrO2/c1-18-15-9-8-14(13-6-4-3-5-7-13)12-16(15,19-2)10-11-17/h3-9H,10-12H2,1-2H3 |
| InChIKey | GGFMANLEFJBCNQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene?
The IUPAC name of 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene (CID 174529615) is 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene.
What is the SMILES notation for 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene?
The canonical SMILES for 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene is COC1=CC=C(c2ccccc2)CC1(CCBr)OC.
What is the InChIKey of 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene?
The InChIKey is GGFMANLEFJBCNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrO2/c1-18-15-9-8-14(13-6-4-3-5-7-13)12-16(15,19-2)10-11-17/h3-9H,10-12H2,1-2H3.
What are the key properties of 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene?
5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene has a molecular weight of 323.23 g/mol, XLogP of 4.17, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromoethyl)-4,5-dimethoxy-1-phenylcyclohexa-1,3-diene is sourced from PubChem (CID 174529615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).