About cyclopropyl 4-(methylamino)benzenesulfonate
cyclopropyl 4-(methylamino)benzenesulfonate (PubChem CID 174529833) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is cyclopropyl 4-(methylamino)benzenesulfonate.
Molecular Properties
| Compound Name | cyclopropyl 4-(methylamino)benzenesulfonate |
| PubChem CID | 174529833 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | cyclopropyl 4-(methylamino)benzenesulfonate |
| SMILES | CNc1ccc(S(=O)(=O)OC2CC2)cc1 |
| InChI | InChI=1S/C10H13NO3S/c1-11-8-2-6-10(7-3-8)15(12,13)14-9-4-5-9/h2-3,6-7,9,11H,4-5H2,1H3 |
| InChIKey | RAAYYJLYUKMWLT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopropyl 4-(methylamino)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl 4-(methylamino)benzenesulfonate?
The IUPAC name of cyclopropyl 4-(methylamino)benzenesulfonate (CID 174529833) is cyclopropyl 4-(methylamino)benzenesulfonate.
What is the SMILES notation for cyclopropyl 4-(methylamino)benzenesulfonate?
The canonical SMILES for cyclopropyl 4-(methylamino)benzenesulfonate is CNc1ccc(S(=O)(=O)OC2CC2)cc1.
What is the InChIKey of cyclopropyl 4-(methylamino)benzenesulfonate?
The InChIKey is RAAYYJLYUKMWLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S/c1-11-8-2-6-10(7-3-8)15(12,13)14-9-4-5-9/h2-3,6-7,9,11H,4-5H2,1H3.
What are the key properties of cyclopropyl 4-(methylamino)benzenesulfonate?
cyclopropyl 4-(methylamino)benzenesulfonate has a molecular weight of 227.28 g/mol, XLogP of 1.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl 4-(methylamino)benzenesulfonate is sourced from PubChem (CID 174529833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).