About sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate
sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate (PubChem CID 174530568) has the molecular formula C3H9N4NaO6S2
and a molecular weight of 284.25 g/mol. Its IUPAC name is sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate.
Molecular Properties
| Compound Name | sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate |
| PubChem CID | 174530568 |
| Molecular Formula | C3H9N4NaO6S2 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate |
| SMILES | NC(N)=NCC(=O)OS(=O)(=O)S(N)(=O)=O.[H-].[Na+] |
| InChI | InChI=1S/C3H8N4O6S2.Na.H/c4-3(5)7-1-2(8)13-15(11,12)14(6,9)10;;/h1H2,(H4,4,5,7)(H2,6,9,10);;/q;+1;-1 |
| InChIKey | AFELMZXLDCBITE-UHFFFAOYSA-N |
| XLogP | -6.55 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | -6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate?
The IUPAC name of sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate (CID 174530568) is sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate.
What is the SMILES notation for sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate?
The canonical SMILES for sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate is NC(N)=NCC(=O)OS(=O)(=O)S(N)(=O)=O.[H-].[Na+].
What is the InChIKey of sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate?
The InChIKey is AFELMZXLDCBITE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N4O6S2.Na.H/c4-3(5)7-1-2(8)13-15(11,12)14(6,9)10;;/h1H2,(H4,4,5,7)(H2,6,9,10);;/q;+1;-1.
What are the key properties of sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate?
sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate has a molecular weight of 284.25 g/mol, XLogP of -6.55, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;sulfamoylsulfonyl 2-(diaminomethylideneamino)acetate is sourced from PubChem (CID 174530568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).